2-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)acetic acid

C11H11NO4 — CID 3239077

IUPAC2-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)acetic acid
SMILESCc1ccc2c(c1)N(CC(=O)O)C(=O)CO2
InChIInChI=1S/C11H11NO4/c1-7-2-3-9-8(4-7)12(5-11(14)15)10(13)6-16-9/h2-4H,5-6H2,1H3,(H,14,15)
InChIKeyBVVMGUNQSDWSQG-UHFFFAOYSA-N
MW221.21 g/mol
LogP0.81
Rot. Bonds2

About 2-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)acetic acid

2-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)acetic acid (PubChem CID 3239077) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 2-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)acetic acid.

Molecular Properties

Compound Name2-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)acetic acid
PubChem CID3239077
Molecular FormulaC11H11NO4
Molecular Weight221.21 g/mol
Exact Mass221.07
IUPAC Name2-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)acetic acid
SMILESCc1ccc2c(c1)N(CC(=O)O)C(=O)CO2
InChIInChI=1S/C11H11NO4/c1-7-2-3-9-8(4-7)12(5-11(14)15)10(13)6-16-9/h2-4H,5-6H2,1H3,(H,14,15)
InChIKeyBVVMGUNQSDWSQG-UHFFFAOYSA-N
XLogP0.81
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.21
LogP ≤ 50.81
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)acetic acid?
The IUPAC name of 2-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)acetic acid (CID 3239077) is 2-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)acetic acid.
What is the SMILES notation for 2-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)acetic acid?
The canonical SMILES for 2-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)acetic acid is Cc1ccc2c(c1)N(CC(=O)O)C(=O)CO2.
What is the InChIKey of 2-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)acetic acid?
The InChIKey is BVVMGUNQSDWSQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO4/c1-7-2-3-9-8(4-7)12(5-11(14)15)10(13)6-16-9/h2-4H,5-6H2,1H3,(H,14,15).
What are the key properties of 2-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)acetic acid?
2-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)acetic acid has a molecular weight of 221.21 g/mol, XLogP of 0.81, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)acetic acid is sourced from PubChem (CID 3239077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).