C17H32N4O5S — CID 3239360
ethyl 4-[1-(diethylsulfamoyl)piperidine-4-carbonyl]piperazine-1-carboxylate (PubChem CID 3239360) has the molecular formula C17H32N4O5S and a molecular weight of 404.53 g/mol. Its IUPAC name is ethyl 4-[1-(diethylsulfamoyl)piperidine-4-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[1-(diethylsulfamoyl)piperidine-4-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 3239360 |
| Molecular Formula | C17H32N4O5S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | ethyl 4-[1-(diethylsulfamoyl)piperidine-4-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C2CCN(S(=O)(=O)N(CC)CC)CC2)CC1 |
| InChI | InChI=1S/C17H32N4O5S/c1-4-20(5-2)27(24,25)21-9-7-15(8-10-21)16(22)18-11-13-19(14-12-18)17(23)26-6-3/h15H,4-14H2,1-3H3 |
| InChIKey | AGFJICQANHQZIQ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 90.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |