C18H17N3O6S — CID 3239422
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,4-dimethyl-2,3-dioxoquinoxaline-6-sulfonamide (PubChem CID 3239422) has the molecular formula C18H17N3O6S and a molecular weight of 403.42 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,4-dimethyl-2,3-dioxoquinoxaline-6-sulfonamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,4-dimethyl-2,3-dioxoquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 3239422 |
| Molecular Formula | C18H17N3O6S |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,4-dimethyl-2,3-dioxoquinoxaline-6-sulfonamide |
| SMILES | Cn1c(=O)c(=O)n(C)c2cc(S(=O)(=O)Nc3ccc4c(c3)OCCO4)ccc21 |
| InChI | InChI=1S/C18H17N3O6S/c1-20-13-5-4-12(10-14(13)21(2)18(23)17(20)22)28(24,25)19-11-3-6-15-16(9-11)27-8-7-26-15/h3-6,9-10,19H,7-8H2,1-2H3 |
| InChIKey | AJLFQFYMLRXVHV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|