About 4-[(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methyl-(2-phenylethyl)amino]-4-oxobutanoic acid
4-[(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methyl-(2-phenylethyl)amino]-4-oxobutanoic acid (PubChem CID 3239442) has the molecular formula C22H28N2O5
and a molecular weight of 400.48 g/mol. Its IUPAC name is 4-[(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methyl-(2-phenylethyl)amino]-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methyl-(2-phenylethyl)amino]-4-oxobutanoic acid |
| PubChem CID | 3239442 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 4-[(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methyl-(2-phenylethyl)amino]-4-oxobutanoic acid |
| SMILES | CCOC(=O)c1[nH]c(C)c(CN(CCc2ccccc2)C(=O)CCC(=O)O)c1C |
| InChI | InChI=1S/C22H28N2O5/c1-4-29-22(28)21-15(2)18(16(3)23-21)14-24(19(25)10-11-20(26)27)13-12-17-8-6-5-7-9-17/h5-9,23H,4,10-14H2,1-3H3,(H,26,27) |
| InChIKey | ASEIPTJQVIMPFX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methyl-(2-phenylethyl)amino]-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methyl-(2-phenylethyl)amino]-4-oxobutanoic acid?
The IUPAC name of 4-[(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methyl-(2-phenylethyl)amino]-4-oxobutanoic acid (CID 3239442) is 4-[(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methyl-(2-phenylethyl)amino]-4-oxobutanoic acid.
What is the SMILES notation for 4-[(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methyl-(2-phenylethyl)amino]-4-oxobutanoic acid?
The canonical SMILES for 4-[(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methyl-(2-phenylethyl)amino]-4-oxobutanoic acid is CCOC(=O)c1[nH]c(C)c(CN(CCc2ccccc2)C(=O)CCC(=O)O)c1C.
What is the InChIKey of 4-[(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methyl-(2-phenylethyl)amino]-4-oxobutanoic acid?
The InChIKey is ASEIPTJQVIMPFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2O5/c1-4-29-22(28)21-15(2)18(16(3)23-21)14-24(19(25)10-11-20(26)27)13-12-17-8-6-5-7-9-17/h5-9,23H,4,10-14H2,1-3H3,(H,26,27).
What are the key properties of 4-[(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methyl-(2-phenylethyl)amino]-4-oxobutanoic acid?
4-[(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methyl-(2-phenylethyl)amino]-4-oxobutanoic acid has a molecular weight of 400.48 g/mol, XLogP of 3.24, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methyl-(2-phenylethyl)amino]-4-oxobutanoic acid is sourced from PubChem (CID 3239442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).