C22H30O6 — CID 3239556
2-[6-(4,4-dimethyl-2,6-dioxocyclohexyl)-6-oxohexanoyl]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 3239556) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is 2-[6-(4,4-dimethyl-2,6-dioxocyclohexyl)-6-oxohexanoyl]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[6-(4,4-dimethyl-2,6-dioxocyclohexyl)-6-oxohexanoyl]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 3239556 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 2-[6-(4,4-dimethyl-2,6-dioxocyclohexyl)-6-oxohexanoyl]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)C(C(=O)CCCCC(=O)C2C(=O)CC(C)(C)CC2=O)C(=O)C1 |
| InChI | InChI=1S/C22H30O6/c1-21(2)9-15(25)19(16(26)10-21)13(23)7-5-6-8-14(24)20-17(27)11-22(3,4)12-18(20)28/h19-20H,5-12H2,1-4H3 |
| InChIKey | WYLIIXXBYSXLGN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|