About 5-(3,4-dimethoxyphenyl)-N-(pyridin-3-ylmethyl)-1,2-oxazole-3-carboxamide
5-(3,4-dimethoxyphenyl)-N-(pyridin-3-ylmethyl)-1,2-oxazole-3-carboxamide (PubChem CID 3239565) has the molecular formula C18H17N3O4
and a molecular weight of 339.35 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-N-(pyridin-3-ylmethyl)-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-(3,4-dimethoxyphenyl)-N-(pyridin-3-ylmethyl)-1,2-oxazole-3-carboxamide |
| PubChem CID | 3239565 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-N-(pyridin-3-ylmethyl)-1,2-oxazole-3-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NCc3cccnc3)no2)cc1OC |
| InChI | InChI=1S/C18H17N3O4/c1-23-15-6-5-13(8-17(15)24-2)16-9-14(21-25-16)18(22)20-11-12-4-3-7-19-10-12/h3-10H,11H2,1-2H3,(H,20,22) |
| InChIKey | UKVFKUBKSCLWGT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(3,4-dimethoxyphenyl)-N-(pyridin-3-ylmethyl)-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dimethoxyphenyl)-N-(pyridin-3-ylmethyl)-1,2-oxazole-3-carboxamide?
The IUPAC name of 5-(3,4-dimethoxyphenyl)-N-(pyridin-3-ylmethyl)-1,2-oxazole-3-carboxamide (CID 3239565) is 5-(3,4-dimethoxyphenyl)-N-(pyridin-3-ylmethyl)-1,2-oxazole-3-carboxamide.
What is the SMILES notation for 5-(3,4-dimethoxyphenyl)-N-(pyridin-3-ylmethyl)-1,2-oxazole-3-carboxamide?
The canonical SMILES for 5-(3,4-dimethoxyphenyl)-N-(pyridin-3-ylmethyl)-1,2-oxazole-3-carboxamide is COc1ccc(-c2cc(C(=O)NCc3cccnc3)no2)cc1OC.
What is the InChIKey of 5-(3,4-dimethoxyphenyl)-N-(pyridin-3-ylmethyl)-1,2-oxazole-3-carboxamide?
The InChIKey is UKVFKUBKSCLWGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O4/c1-23-15-6-5-13(8-17(15)24-2)16-9-14(21-25-16)18(22)20-11-12-4-3-7-19-10-12/h3-10H,11H2,1-2H3,(H,20,22).
What are the key properties of 5-(3,4-dimethoxyphenyl)-N-(pyridin-3-ylmethyl)-1,2-oxazole-3-carboxamide?
5-(3,4-dimethoxyphenyl)-N-(pyridin-3-ylmethyl)-1,2-oxazole-3-carboxamide has a molecular weight of 339.35 g/mol, XLogP of 2.68, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dimethoxyphenyl)-N-(pyridin-3-ylmethyl)-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 3239565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).