C11H13N3O3S — CID 3239579
4-(1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)butanamide (PubChem CID 3239579) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is 4-(1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)butanamide.
| Compound Name | 4-(1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)butanamide |
|---|---|
| PubChem CID | 3239579 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 4-(1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)butanamide |
| SMILES | NC(=O)CCCC1=NS(=O)(=O)c2ccccc2N1 |
| InChI | InChI=1S/C11H13N3O3S/c12-10(15)6-3-7-11-13-8-4-1-2-5-9(8)18(16,17)14-11/h1-2,4-5H,3,6-7H2,(H2,12,15)(H,13,14) |
| InChIKey | KMJUSGMMMQAWGB-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |