C21H30N4O5 — CID 3239828
N-cyclohexyl-2-[[2-(2,5-dioxoimidazolidin-4-yl)acetyl]-(furan-2-ylmethyl)amino]-2-methylbutanamide (PubChem CID 3239828) has the molecular formula C21H30N4O5 and a molecular weight of 418.49 g/mol. Its IUPAC name is N-cyclohexyl-2-[[2-(2,5-dioxoimidazolidin-4-yl)acetyl]-(furan-2-ylmethyl)amino]-2-methylbutanamide.
| Compound Name | N-cyclohexyl-2-[[2-(2,5-dioxoimidazolidin-4-yl)acetyl]-(furan-2-ylmethyl)amino]-2-methylbutanamide |
|---|---|
| PubChem CID | 3239828 |
| Molecular Formula | C21H30N4O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | N-cyclohexyl-2-[[2-(2,5-dioxoimidazolidin-4-yl)acetyl]-(furan-2-ylmethyl)amino]-2-methylbutanamide |
| SMILES | CCC(C)(C(=O)NC1CCCCC1)N(Cc1ccco1)C(=O)CC1NC(=O)NC1=O |
| InChI | InChI=1S/C21H30N4O5/c1-3-21(2,19(28)22-14-8-5-4-6-9-14)25(13-15-10-7-11-30-15)17(26)12-16-18(27)24-20(29)23-16/h7,10-11,14,16H,3-6,8-9,12-13H2,1-2H3,(H,22,28)(H2,23,24,27,29) |
| InChIKey | ZDVQYMOTBLSDCF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|