About [4-(methoxycarbonylamino)thiolan-3-yl] 2-(1,3-dioxoisoindol-2-yl)acetate
[4-(methoxycarbonylamino)thiolan-3-yl] 2-(1,3-dioxoisoindol-2-yl)acetate (PubChem CID 3239854) has the molecular formula C16H16N2O6S
and a molecular weight of 364.38 g/mol. Its IUPAC name is [4-(methoxycarbonylamino)thiolan-3-yl] 2-(1,3-dioxoisoindol-2-yl)acetate.
Molecular Properties
| Compound Name | [4-(methoxycarbonylamino)thiolan-3-yl] 2-(1,3-dioxoisoindol-2-yl)acetate |
| PubChem CID | 3239854 |
| Molecular Formula | C16H16N2O6S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | [4-(methoxycarbonylamino)thiolan-3-yl] 2-(1,3-dioxoisoindol-2-yl)acetate |
| SMILES | COC(=O)NC1CSCC1OC(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H16N2O6S/c1-23-16(22)17-11-7-25-8-12(11)24-13(19)6-18-14(20)9-4-2-3-5-10(9)15(18)21/h2-5,11-12H,6-8H2,1H3,(H,17,22) |
| InChIKey | LQFFEUFPCVWAOA-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [4-(methoxycarbonylamino)thiolan-3-yl] 2-(1,3-dioxoisoindol-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(methoxycarbonylamino)thiolan-3-yl] 2-(1,3-dioxoisoindol-2-yl)acetate?
The IUPAC name of [4-(methoxycarbonylamino)thiolan-3-yl] 2-(1,3-dioxoisoindol-2-yl)acetate (CID 3239854) is [4-(methoxycarbonylamino)thiolan-3-yl] 2-(1,3-dioxoisoindol-2-yl)acetate.
What is the SMILES notation for [4-(methoxycarbonylamino)thiolan-3-yl] 2-(1,3-dioxoisoindol-2-yl)acetate?
The canonical SMILES for [4-(methoxycarbonylamino)thiolan-3-yl] 2-(1,3-dioxoisoindol-2-yl)acetate is COC(=O)NC1CSCC1OC(=O)CN1C(=O)c2ccccc2C1=O.
What is the InChIKey of [4-(methoxycarbonylamino)thiolan-3-yl] 2-(1,3-dioxoisoindol-2-yl)acetate?
The InChIKey is LQFFEUFPCVWAOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O6S/c1-23-16(22)17-11-7-25-8-12(11)24-13(19)6-18-14(20)9-4-2-3-5-10(9)15(18)21/h2-5,11-12H,6-8H2,1H3,(H,17,22).
What are the key properties of [4-(methoxycarbonylamino)thiolan-3-yl] 2-(1,3-dioxoisoindol-2-yl)acetate?
[4-(methoxycarbonylamino)thiolan-3-yl] 2-(1,3-dioxoisoindol-2-yl)acetate has a molecular weight of 364.38 g/mol, XLogP of 0.67, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(methoxycarbonylamino)thiolan-3-yl] 2-(1,3-dioxoisoindol-2-yl)acetate is sourced from PubChem (CID 3239854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).