C19H39N3O4S — CID 3239925
1-[bis(2-methylpropyl)sulfamoyl]-N-(3-ethoxypropyl)piperidine-4-carboxamide (PubChem CID 3239925) has the molecular formula C19H39N3O4S and a molecular weight of 405.61 g/mol. Its IUPAC name is 1-[bis(2-methylpropyl)sulfamoyl]-N-(3-ethoxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-[bis(2-methylpropyl)sulfamoyl]-N-(3-ethoxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3239925 |
| Molecular Formula | C19H39N3O4S |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | 1-[bis(2-methylpropyl)sulfamoyl]-N-(3-ethoxypropyl)piperidine-4-carboxamide |
| SMILES | CCOCCCNC(=O)C1CCN(S(=O)(=O)N(CC(C)C)CC(C)C)CC1 |
| InChI | InChI=1S/C19H39N3O4S/c1-6-26-13-7-10-20-19(23)18-8-11-21(12-9-18)27(24,25)22(14-16(2)3)15-17(4)5/h16-18H,6-15H2,1-5H3,(H,20,23) |
| InChIKey | GFNFCKXMBRCZGG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|