C19H16N2O3S — CID 3239947
benzyl 2-amino-5-cyano-4-(furan-3-yl)-6-methyl-4H-thiopyran-3-carboxylate (PubChem CID 3239947) has the molecular formula C19H16N2O3S and a molecular weight of 352.42 g/mol. Its IUPAC name is benzyl 2-amino-5-cyano-4-(furan-3-yl)-6-methyl-4H-thiopyran-3-carboxylate.
| Compound Name | benzyl 2-amino-5-cyano-4-(furan-3-yl)-6-methyl-4H-thiopyran-3-carboxylate |
|---|---|
| PubChem CID | 3239947 |
| Molecular Formula | C19H16N2O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | benzyl 2-amino-5-cyano-4-(furan-3-yl)-6-methyl-4H-thiopyran-3-carboxylate |
| SMILES | CC1=C(C#N)C(c2ccoc2)C(C(=O)OCc2ccccc2)=C(N)S1 |
| InChI | InChI=1S/C19H16N2O3S/c1-12-15(9-20)16(14-7-8-23-11-14)17(18(21)25-12)19(22)24-10-13-5-3-2-4-6-13/h2-8,11,16H,10,21H2,1H3 |
| InChIKey | JORMHOILXHNTOR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |