About 4-acetyl-3,5-dimethyl-N-[2-(4-methylpiperidin-1-yl)ethyl]-1H-pyrrole-2-carboxamide
4-acetyl-3,5-dimethyl-N-[2-(4-methylpiperidin-1-yl)ethyl]-1H-pyrrole-2-carboxamide (PubChem CID 3239996) has the molecular formula C17H27N3O2
and a molecular weight of 305.42 g/mol. Its IUPAC name is 4-acetyl-3,5-dimethyl-N-[2-(4-methylpiperidin-1-yl)ethyl]-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 4-acetyl-3,5-dimethyl-N-[2-(4-methylpiperidin-1-yl)ethyl]-1H-pyrrole-2-carboxamide |
| PubChem CID | 3239996 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 4-acetyl-3,5-dimethyl-N-[2-(4-methylpiperidin-1-yl)ethyl]-1H-pyrrole-2-carboxamide |
| SMILES | CC(=O)c1c(C)[nH]c(C(=O)NCCN2CCC(C)CC2)c1C |
| InChI | InChI=1S/C17H27N3O2/c1-11-5-8-20(9-6-11)10-7-18-17(22)16-12(2)15(14(4)21)13(3)19-16/h11,19H,5-10H2,1-4H3,(H,18,22) |
| InChIKey | BNANBSRYBXHOBD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-acetyl-3,5-dimethyl-N-[2-(4-methylpiperidin-1-yl)ethyl]-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-3,5-dimethyl-N-[2-(4-methylpiperidin-1-yl)ethyl]-1H-pyrrole-2-carboxamide?
The IUPAC name of 4-acetyl-3,5-dimethyl-N-[2-(4-methylpiperidin-1-yl)ethyl]-1H-pyrrole-2-carboxamide (CID 3239996) is 4-acetyl-3,5-dimethyl-N-[2-(4-methylpiperidin-1-yl)ethyl]-1H-pyrrole-2-carboxamide.
What is the SMILES notation for 4-acetyl-3,5-dimethyl-N-[2-(4-methylpiperidin-1-yl)ethyl]-1H-pyrrole-2-carboxamide?
The canonical SMILES for 4-acetyl-3,5-dimethyl-N-[2-(4-methylpiperidin-1-yl)ethyl]-1H-pyrrole-2-carboxamide is CC(=O)c1c(C)[nH]c(C(=O)NCCN2CCC(C)CC2)c1C.
What is the InChIKey of 4-acetyl-3,5-dimethyl-N-[2-(4-methylpiperidin-1-yl)ethyl]-1H-pyrrole-2-carboxamide?
The InChIKey is BNANBSRYBXHOBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N3O2/c1-11-5-8-20(9-6-11)10-7-18-17(22)16-12(2)15(14(4)21)13(3)19-16/h11,19H,5-10H2,1-4H3,(H,18,22).
What are the key properties of 4-acetyl-3,5-dimethyl-N-[2-(4-methylpiperidin-1-yl)ethyl]-1H-pyrrole-2-carboxamide?
4-acetyl-3,5-dimethyl-N-[2-(4-methylpiperidin-1-yl)ethyl]-1H-pyrrole-2-carboxamide has a molecular weight of 305.42 g/mol, XLogP of 2.30, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-3,5-dimethyl-N-[2-(4-methylpiperidin-1-yl)ethyl]-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 3239996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).