About azepan-1-yl-[5-(2,2,2-trifluoroethoxymethyl)furan-2-yl]methanone
azepan-1-yl-[5-(2,2,2-trifluoroethoxymethyl)furan-2-yl]methanone (PubChem CID 3240013) has the molecular formula C14H18F3NO3
and a molecular weight of 305.30 g/mol. Its IUPAC name is azepan-1-yl-[5-(2,2,2-trifluoroethoxymethyl)furan-2-yl]methanone.
Molecular Properties
| Compound Name | azepan-1-yl-[5-(2,2,2-trifluoroethoxymethyl)furan-2-yl]methanone |
| PubChem CID | 3240013 |
| Molecular Formula | C14H18F3NO3 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | azepan-1-yl-[5-(2,2,2-trifluoroethoxymethyl)furan-2-yl]methanone |
| SMILES | O=C(c1ccc(COCC(F)(F)F)o1)N1CCCCCC1 |
| InChI | InChI=1S/C14H18F3NO3/c15-14(16,17)10-20-9-11-5-6-12(21-11)13(19)18-7-3-1-2-4-8-18/h5-6H,1-4,7-10H2 |
| InChIKey | NYNKDCKLXBPPCC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azepan-1-yl-[5-(2,2,2-trifluoroethoxymethyl)furan-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepan-1-yl-[5-(2,2,2-trifluoroethoxymethyl)furan-2-yl]methanone?
The IUPAC name of azepan-1-yl-[5-(2,2,2-trifluoroethoxymethyl)furan-2-yl]methanone (CID 3240013) is azepan-1-yl-[5-(2,2,2-trifluoroethoxymethyl)furan-2-yl]methanone.
What is the SMILES notation for azepan-1-yl-[5-(2,2,2-trifluoroethoxymethyl)furan-2-yl]methanone?
The canonical SMILES for azepan-1-yl-[5-(2,2,2-trifluoroethoxymethyl)furan-2-yl]methanone is O=C(c1ccc(COCC(F)(F)F)o1)N1CCCCCC1.
What is the InChIKey of azepan-1-yl-[5-(2,2,2-trifluoroethoxymethyl)furan-2-yl]methanone?
The InChIKey is NYNKDCKLXBPPCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18F3NO3/c15-14(16,17)10-20-9-11-5-6-12(21-11)13(19)18-7-3-1-2-4-8-18/h5-6H,1-4,7-10H2.
What are the key properties of azepan-1-yl-[5-(2,2,2-trifluoroethoxymethyl)furan-2-yl]methanone?
azepan-1-yl-[5-(2,2,2-trifluoroethoxymethyl)furan-2-yl]methanone has a molecular weight of 305.30 g/mol, XLogP of 3.37, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azepan-1-yl-[5-(2,2,2-trifluoroethoxymethyl)furan-2-yl]methanone is sourced from PubChem (CID 3240013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).