C22H26N2O6 — CID 3240040
3-[2-(3,4-dimethoxyphenyl)ethyl]-6,7-diethoxy-1H-quinazoline-2,4-dione (PubChem CID 3240040) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethyl]-6,7-diethoxy-1H-quinazoline-2,4-dione.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-6,7-diethoxy-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 3240040 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-6,7-diethoxy-1H-quinazoline-2,4-dione |
| SMILES | CCOc1cc2[nH]c(=O)n(CCc3ccc(OC)c(OC)c3)c(=O)c2cc1OCC |
| InChI | InChI=1S/C22H26N2O6/c1-5-29-19-12-15-16(13-20(19)30-6-2)23-22(26)24(21(15)25)10-9-14-7-8-17(27-3)18(11-14)28-4/h7-8,11-13H,5-6,9-10H2,1-4H3,(H,23,26) |
| InChIKey | SSFMZJBPSKQJNT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |