C27H35FN4O2S — CID 3240053
N-[3-(diethylamino)propyl]-1-[4-[(4-fluorophenyl)methyl]thieno[3,2-b]pyrrole-5-carbonyl]piperidine-4-carboxamide (PubChem CID 3240053) has the molecular formula C27H35FN4O2S and a molecular weight of 498.67 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-1-[4-[(4-fluorophenyl)methyl]thieno[3,2-b]pyrrole-5-carbonyl]piperidine-4-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-1-[4-[(4-fluorophenyl)methyl]thieno[3,2-b]pyrrole-5-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3240053 |
| Molecular Formula | C27H35FN4O2S |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | N-[3-(diethylamino)propyl]-1-[4-[(4-fluorophenyl)methyl]thieno[3,2-b]pyrrole-5-carbonyl]piperidine-4-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)C1CCN(C(=O)c2cc3sccc3n2Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C27H35FN4O2S/c1-3-30(4-2)14-5-13-29-26(33)21-10-15-31(16-11-21)27(34)24-18-25-23(12-17-35-25)32(24)19-20-6-8-22(28)9-7-20/h6-9,12,17-18,21H,3-5,10-11,13-16,19H2,1-2H3,(H,29,33) |
| InChIKey | CGLDXASLXYKRPB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|