C22H22N4O3 — CID 3240157
N-[2-(4-methoxyanilino)-1-(4-methylphenyl)-2-oxoethyl]-N-methylpyrazine-2-carboxamide (PubChem CID 3240157) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is N-[2-(4-methoxyanilino)-1-(4-methylphenyl)-2-oxoethyl]-N-methylpyrazine-2-carboxamide.
| Compound Name | N-[2-(4-methoxyanilino)-1-(4-methylphenyl)-2-oxoethyl]-N-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 3240157 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N-[2-(4-methoxyanilino)-1-(4-methylphenyl)-2-oxoethyl]-N-methylpyrazine-2-carboxamide |
| SMILES | COc1ccc(NC(=O)C(c2ccc(C)cc2)N(C)C(=O)c2cnccn2)cc1 |
| InChI | InChI=1S/C22H22N4O3/c1-15-4-6-16(7-5-15)20(26(2)22(28)19-14-23-12-13-24-19)21(27)25-17-8-10-18(29-3)11-9-17/h4-14,20H,1-3H3,(H,25,27) |
| InChIKey | ITQMUXLKFHALHH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |