About N-(5-methyl-2,1,3-benzothiadiazol-4-yl)-N-methylsulfonylmethanesulfonamide
N-(5-methyl-2,1,3-benzothiadiazol-4-yl)-N-methylsulfonylmethanesulfonamide (PubChem CID 3240195) has the molecular formula C9H11N3O4S3
and a molecular weight of 321.41 g/mol. Its IUPAC name is N-(5-methyl-2,1,3-benzothiadiazol-4-yl)-N-methylsulfonylmethanesulfonamide.
Molecular Properties
| Compound Name | N-(5-methyl-2,1,3-benzothiadiazol-4-yl)-N-methylsulfonylmethanesulfonamide |
| PubChem CID | 3240195 |
| Molecular Formula | C9H11N3O4S3 |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | N-(5-methyl-2,1,3-benzothiadiazol-4-yl)-N-methylsulfonylmethanesulfonamide |
| SMILES | Cc1ccc2nsnc2c1N(S(C)(=O)=O)S(C)(=O)=O |
| InChI | InChI=1S/C9H11N3O4S3/c1-6-4-5-7-8(11-17-10-7)9(6)12(18(2,13)14)19(3,15)16/h4-5H,1-3H3 |
| InChIKey | DSRNDXPEDYIAPB-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 97.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(5-methyl-2,1,3-benzothiadiazol-4-yl)-N-methylsulfonylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-methyl-2,1,3-benzothiadiazol-4-yl)-N-methylsulfonylmethanesulfonamide?
The IUPAC name of N-(5-methyl-2,1,3-benzothiadiazol-4-yl)-N-methylsulfonylmethanesulfonamide (CID 3240195) is N-(5-methyl-2,1,3-benzothiadiazol-4-yl)-N-methylsulfonylmethanesulfonamide.
What is the SMILES notation for N-(5-methyl-2,1,3-benzothiadiazol-4-yl)-N-methylsulfonylmethanesulfonamide?
The canonical SMILES for N-(5-methyl-2,1,3-benzothiadiazol-4-yl)-N-methylsulfonylmethanesulfonamide is Cc1ccc2nsnc2c1N(S(C)(=O)=O)S(C)(=O)=O.
What is the InChIKey of N-(5-methyl-2,1,3-benzothiadiazol-4-yl)-N-methylsulfonylmethanesulfonamide?
The InChIKey is DSRNDXPEDYIAPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O4S3/c1-6-4-5-7-8(11-17-10-7)9(6)12(18(2,13)14)19(3,15)16/h4-5H,1-3H3.
What are the key properties of N-(5-methyl-2,1,3-benzothiadiazol-4-yl)-N-methylsulfonylmethanesulfonamide?
N-(5-methyl-2,1,3-benzothiadiazol-4-yl)-N-methylsulfonylmethanesulfonamide has a molecular weight of 321.41 g/mol, XLogP of 0.73, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-methyl-2,1,3-benzothiadiazol-4-yl)-N-methylsulfonylmethanesulfonamide is sourced from PubChem (CID 3240195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).