C17H20N2O5S — CID 3240209
ethyl 2-(3,4-dimethoxybenzoyl)imino-3,4-dimethyl-1,3-thiazole-5-carboxylate (PubChem CID 3240209) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is ethyl 2-(3,4-dimethoxybenzoyl)imino-3,4-dimethyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-(3,4-dimethoxybenzoyl)imino-3,4-dimethyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 3240209 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | ethyl 2-(3,4-dimethoxybenzoyl)imino-3,4-dimethyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1s/c(=N/C(=O)c2ccc(OC)c(OC)c2)n(C)c1C |
| InChI | InChI=1S/C17H20N2O5S/c1-6-24-16(21)14-10(2)19(3)17(25-14)18-15(20)11-7-8-12(22-4)13(9-11)23-5/h7-9H,6H2,1-5H3/b18-17+ |
| InChIKey | KSJWSURRFMYMDY-ISLYRVAYSA-N |
| XLogP | 2.33 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|