C14H12N4O4S — CID 3240399
(1,3-dioxoisoindol-2-yl)methyl 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetate (PubChem CID 3240399) has the molecular formula C14H12N4O4S and a molecular weight of 332.34 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 3240399 |
| Molecular Formula | C14H12N4O4S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetate |
| SMILES | Cn1cnnc1SCC(=O)OCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H12N4O4S/c1-17-7-15-16-14(17)23-6-11(19)22-8-18-12(20)9-4-2-3-5-10(9)13(18)21/h2-5,7H,6,8H2,1H3 |
| InChIKey | UTBVEYSMDFQQKR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|