C17H16N2O5S2 — CID 3240408
3-[(6-methylsulfonyl-1,3-benzothiazol-2-yl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 3240408) has the molecular formula C17H16N2O5S2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 3-[(6-methylsulfonyl-1,3-benzothiazol-2-yl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 3-[(6-methylsulfonyl-1,3-benzothiazol-2-yl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 3240408 |
| Molecular Formula | C17H16N2O5S2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 3-[(6-methylsulfonyl-1,3-benzothiazol-2-yl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CS(=O)(=O)c1ccc2nc(NC(=O)C3C4C=CC(C4)C3C(=O)O)sc2c1 |
| InChI | InChI=1S/C17H16N2O5S2/c1-26(23,24)10-4-5-11-12(7-10)25-17(18-11)19-15(20)13-8-2-3-9(6-8)14(13)16(21)22/h2-5,7-9,13-14H,6H2,1H3,(H,21,22)(H,18,19,20) |
| InChIKey | VCXQHHJYPXWYIK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|