About 3-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-[(4-methylphenyl)methyl]propanamide
3-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-[(4-methylphenyl)methyl]propanamide (PubChem CID 3240456) has the molecular formula C17H17N3O3S2
and a molecular weight of 375.48 g/mol. Its IUPAC name is 3-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-[(4-methylphenyl)methyl]propanamide.
Molecular Properties
| Compound Name | 3-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-[(4-methylphenyl)methyl]propanamide |
| PubChem CID | 3240456 |
| Molecular Formula | C17H17N3O3S2 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 3-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-[(4-methylphenyl)methyl]propanamide |
| SMILES | Cc1ccc(CNC(=O)CCS(=O)(=O)c2cccc3nsnc23)cc1 |
| InChI | InChI=1S/C17H17N3O3S2/c1-12-5-7-13(8-6-12)11-18-16(21)9-10-25(22,23)15-4-2-3-14-17(15)20-24-19-14/h2-8H,9-11H2,1H3,(H,18,21) |
| InChIKey | XDKJYSFXSBVDNX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-[(4-methylphenyl)methyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-[(4-methylphenyl)methyl]propanamide?
The IUPAC name of 3-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-[(4-methylphenyl)methyl]propanamide (CID 3240456) is 3-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-[(4-methylphenyl)methyl]propanamide.
What is the SMILES notation for 3-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-[(4-methylphenyl)methyl]propanamide?
The canonical SMILES for 3-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-[(4-methylphenyl)methyl]propanamide is Cc1ccc(CNC(=O)CCS(=O)(=O)c2cccc3nsnc23)cc1.
What is the InChIKey of 3-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-[(4-methylphenyl)methyl]propanamide?
The InChIKey is XDKJYSFXSBVDNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O3S2/c1-12-5-7-13(8-6-12)11-18-16(21)9-10-25(22,23)15-4-2-3-14-17(15)20-24-19-14/h2-8H,9-11H2,1H3,(H,18,21).
What are the key properties of 3-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-[(4-methylphenyl)methyl]propanamide?
3-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-[(4-methylphenyl)methyl]propanamide has a molecular weight of 375.48 g/mol, XLogP of 2.48, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-[(4-methylphenyl)methyl]propanamide is sourced from PubChem (CID 3240456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).