C17H18N4O3 — CID 3240497
1-[1-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]-3-pyridin-2-ylurea (PubChem CID 3240497) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is 1-[1-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]-3-pyridin-2-ylurea.
| Compound Name | 1-[1-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]-3-pyridin-2-ylurea |
|---|---|
| PubChem CID | 3240497 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 1-[1-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]-3-pyridin-2-ylurea |
| SMILES | CC(NC(=O)Nc1ccccn1)N1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C17H18N4O3/c1-9(19-17(24)20-12-4-2-3-7-18-12)21-15(22)13-10-5-6-11(8-10)14(13)16(21)23/h2-7,9-11,13-14H,8H2,1H3,(H2,18,19,20,24) |
| InChIKey | OOCQXOJFFJJXLF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|