About 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5-oxopyrrolidine-2-carboxamide
1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5-oxopyrrolidine-2-carboxamide (PubChem CID 3240553) has the molecular formula C20H35N3O2
and a molecular weight of 349.52 g/mol. Its IUPAC name is 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5-oxopyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5-oxopyrrolidine-2-carboxamide |
| PubChem CID | 3240553 |
| Molecular Formula | C20H35N3O2 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.27 |
| IUPAC Name | 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5-oxopyrrolidine-2-carboxamide |
| SMILES | CC1CC(C)CN(CCCNC(=O)C2CCC(=O)N2C2CCCC2)C1 |
| InChI | InChI=1S/C20H35N3O2/c1-15-12-16(2)14-22(13-15)11-5-10-21-20(25)18-8-9-19(24)23(18)17-6-3-4-7-17/h15-18H,3-14H2,1-2H3,(H,21,25) |
| InChIKey | ODBQOHMVJQEFQL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5-oxopyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5-oxopyrrolidine-2-carboxamide?
The IUPAC name of 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5-oxopyrrolidine-2-carboxamide (CID 3240553) is 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5-oxopyrrolidine-2-carboxamide.
What is the SMILES notation for 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5-oxopyrrolidine-2-carboxamide?
The canonical SMILES for 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5-oxopyrrolidine-2-carboxamide is CC1CC(C)CN(CCCNC(=O)C2CCC(=O)N2C2CCCC2)C1.
What is the InChIKey of 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5-oxopyrrolidine-2-carboxamide?
The InChIKey is ODBQOHMVJQEFQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H35N3O2/c1-15-12-16(2)14-22(13-15)11-5-10-21-20(25)18-8-9-19(24)23(18)17-6-3-4-7-17/h15-18H,3-14H2,1-2H3,(H,21,25).
What are the key properties of 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5-oxopyrrolidine-2-carboxamide?
1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5-oxopyrrolidine-2-carboxamide has a molecular weight of 349.52 g/mol, XLogP of 2.40, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5-oxopyrrolidine-2-carboxamide is sourced from PubChem (CID 3240553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).