C19H20Cl2N2 — CID 3240640
4-[(3,4-dichlorophenyl)methyl]-2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]quinolin-9-imine (PubChem CID 3240640) has the molecular formula C19H20Cl2N2 and a molecular weight of 347.29 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methyl]-2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]quinolin-9-imine.
| Compound Name | 4-[(3,4-dichlorophenyl)methyl]-2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]quinolin-9-imine |
|---|---|
| PubChem CID | 3240640 |
| Molecular Formula | C19H20Cl2N2 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methyl]-2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]quinolin-9-imine |
| SMILES | [H]/N=c1/c2c(n(Cc3ccc(Cl)c(Cl)c3)c3c1CCC3)CCCC2 |
| InChI | InChI=1S/C19H20Cl2N2/c20-15-9-8-12(10-16(15)21)11-23-17-6-2-1-4-13(17)19(22)14-5-3-7-18(14)23/h8-10,22H,1-7,11H2/b22-19- |
| InChIKey | QFVMLXCCDCNYCS-QOCHGBHMSA-N |
| XLogP | 4.69 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |