About 2-(2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)-N-(2-phenylethyl)acetamide
2-(2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)-N-(2-phenylethyl)acetamide (PubChem CID 3240781) has the molecular formula C21H22N2O4
and a molecular weight of 366.42 g/mol. Its IUPAC name is 2-(2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)-N-(2-phenylethyl)acetamide.
Molecular Properties
| Compound Name | 2-(2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)-N-(2-phenylethyl)acetamide |
| PubChem CID | 3240781 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-(2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)-N-(2-phenylethyl)acetamide |
| SMILES | O=C(CN1C(=O)C2(OCCCO2)c2ccccc21)NCCc1ccccc1 |
| InChI | InChI=1S/C21H22N2O4/c24-19(22-12-11-16-7-2-1-3-8-16)15-23-18-10-5-4-9-17(18)21(20(23)25)26-13-6-14-27-21/h1-5,7-10H,6,11-15H2,(H,22,24) |
| InChIKey | FVFVEWPNFMYCHI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)-N-(2-phenylethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)-N-(2-phenylethyl)acetamide?
The IUPAC name of 2-(2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)-N-(2-phenylethyl)acetamide (CID 3240781) is 2-(2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)-N-(2-phenylethyl)acetamide.
What is the SMILES notation for 2-(2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)-N-(2-phenylethyl)acetamide?
The canonical SMILES for 2-(2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)-N-(2-phenylethyl)acetamide is O=C(CN1C(=O)C2(OCCCO2)c2ccccc21)NCCc1ccccc1.
What is the InChIKey of 2-(2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)-N-(2-phenylethyl)acetamide?
The InChIKey is FVFVEWPNFMYCHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O4/c24-19(22-12-11-16-7-2-1-3-8-16)15-23-18-10-5-4-9-17(18)21(20(23)25)26-13-6-14-27-21/h1-5,7-10H,6,11-15H2,(H,22,24).
What are the key properties of 2-(2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)-N-(2-phenylethyl)acetamide?
2-(2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)-N-(2-phenylethyl)acetamide has a molecular weight of 366.42 g/mol, XLogP of 1.98, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)-N-(2-phenylethyl)acetamide is sourced from PubChem (CID 3240781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).