About 1-N,1-N-dimethyl-4-N-[2-(4-methylphenyl)ethyl]piperidine-1,4-dicarboxamide
1-N,1-N-dimethyl-4-N-[2-(4-methylphenyl)ethyl]piperidine-1,4-dicarboxamide (PubChem CID 3240797) has the molecular formula C18H27N3O2
and a molecular weight of 317.43 g/mol. Its IUPAC name is 1-N,1-N-dimethyl-4-N-[2-(4-methylphenyl)ethyl]piperidine-1,4-dicarboxamide.
Molecular Properties
| Compound Name | 1-N,1-N-dimethyl-4-N-[2-(4-methylphenyl)ethyl]piperidine-1,4-dicarboxamide |
| PubChem CID | 3240797 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 1-N,1-N-dimethyl-4-N-[2-(4-methylphenyl)ethyl]piperidine-1,4-dicarboxamide |
| SMILES | Cc1ccc(CCNC(=O)C2CCN(C(=O)N(C)C)CC2)cc1 |
| InChI | InChI=1S/C18H27N3O2/c1-14-4-6-15(7-5-14)8-11-19-17(22)16-9-12-21(13-10-16)18(23)20(2)3/h4-7,16H,8-13H2,1-3H3,(H,19,22) |
| InChIKey | XJCARFQPAVFFOO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-N,1-N-dimethyl-4-N-[2-(4-methylphenyl)ethyl]piperidine-1,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,1-N-dimethyl-4-N-[2-(4-methylphenyl)ethyl]piperidine-1,4-dicarboxamide?
The IUPAC name of 1-N,1-N-dimethyl-4-N-[2-(4-methylphenyl)ethyl]piperidine-1,4-dicarboxamide (CID 3240797) is 1-N,1-N-dimethyl-4-N-[2-(4-methylphenyl)ethyl]piperidine-1,4-dicarboxamide.
What is the SMILES notation for 1-N,1-N-dimethyl-4-N-[2-(4-methylphenyl)ethyl]piperidine-1,4-dicarboxamide?
The canonical SMILES for 1-N,1-N-dimethyl-4-N-[2-(4-methylphenyl)ethyl]piperidine-1,4-dicarboxamide is Cc1ccc(CCNC(=O)C2CCN(C(=O)N(C)C)CC2)cc1.
What is the InChIKey of 1-N,1-N-dimethyl-4-N-[2-(4-methylphenyl)ethyl]piperidine-1,4-dicarboxamide?
The InChIKey is XJCARFQPAVFFOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3O2/c1-14-4-6-15(7-5-14)8-11-19-17(22)16-9-12-21(13-10-16)18(23)20(2)3/h4-7,16H,8-13H2,1-3H3,(H,19,22).
What are the key properties of 1-N,1-N-dimethyl-4-N-[2-(4-methylphenyl)ethyl]piperidine-1,4-dicarboxamide?
1-N,1-N-dimethyl-4-N-[2-(4-methylphenyl)ethyl]piperidine-1,4-dicarboxamide has a molecular weight of 317.43 g/mol, XLogP of 2.05, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,1-N-dimethyl-4-N-[2-(4-methylphenyl)ethyl]piperidine-1,4-dicarboxamide is sourced from PubChem (CID 3240797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).