C16H16N6O — CID 3240831
5-amino-1-(3-methylphenyl)-N-(pyridin-2-ylmethyl)triazole-4-carboxamide (PubChem CID 3240831) has the molecular formula C16H16N6O and a molecular weight of 308.35 g/mol. Its IUPAC name is 5-amino-1-(3-methylphenyl)-N-(pyridin-2-ylmethyl)triazole-4-carboxamide.
| Compound Name | 5-amino-1-(3-methylphenyl)-N-(pyridin-2-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 3240831 |
| Molecular Formula | C16H16N6O |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 5-amino-1-(3-methylphenyl)-N-(pyridin-2-ylmethyl)triazole-4-carboxamide |
| SMILES | Cc1cccc(-n2nnc(C(=O)NCc3ccccn3)c2N)c1 |
| InChI | InChI=1S/C16H16N6O/c1-11-5-4-7-13(9-11)22-15(17)14(20-21-22)16(23)19-10-12-6-2-3-8-18-12/h2-9H,10,17H2,1H3,(H,19,23) |
| InChIKey | SRSMWECCOYBHMV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |