C15H19NO3S2 — CID 3240940
N-[2-(cyclohexen-1-yl)ethyl]-5,5-dioxo-4,6-dihydrothieno[3,4-b]thiophene-2-carboxamide (PubChem CID 3240940) has the molecular formula C15H19NO3S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-5,5-dioxo-4,6-dihydrothieno[3,4-b]thiophene-2-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-5,5-dioxo-4,6-dihydrothieno[3,4-b]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3240940 |
| Molecular Formula | C15H19NO3S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-5,5-dioxo-4,6-dihydrothieno[3,4-b]thiophene-2-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1cc2c(s1)CS(=O)(=O)C2 |
| InChI | InChI=1S/C15H19NO3S2/c17-15(16-7-6-11-4-2-1-3-5-11)13-8-12-9-21(18,19)10-14(12)20-13/h4,8H,1-3,5-7,9-10H2,(H,16,17) |
| InChIKey | YXZZDXHBBADLKA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|