C12H12ClNO4 — CID 3240998
ethyl 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetate (PubChem CID 3240998) has the molecular formula C12H12ClNO4 and a molecular weight of 269.68 g/mol. Its IUPAC name is ethyl 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetate.
| Compound Name | ethyl 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetate |
|---|---|
| PubChem CID | 3240998 |
| Molecular Formula | C12H12ClNO4 |
| Molecular Weight | 269.68 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | ethyl 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetate |
| SMILES | CCOC(=O)CN1C(=O)COc2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H12ClNO4/c1-2-17-12(16)6-14-9-5-8(13)3-4-10(9)18-7-11(14)15/h3-5H,2,6-7H2,1H3 |
| InChIKey | NZGHBJWHNJXJHE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.68 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |