C23H26N4O3 — CID 3241079
2-(12-methyl-9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-(4-phenylbutan-2-yl)butanamide (PubChem CID 3241079) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is 2-(12-methyl-9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-(4-phenylbutan-2-yl)butanamide.
| Compound Name | 2-(12-methyl-9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-(4-phenylbutan-2-yl)butanamide |
|---|---|
| PubChem CID | 3241079 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 2-(12-methyl-9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-(4-phenylbutan-2-yl)butanamide |
| SMILES | CCC(C(=O)NC(C)CCc1ccccc1)n1nc(C)n2c(cc3occc32)c1=O |
| InChI | InChI=1S/C23H26N4O3/c1-4-18(22(28)24-15(2)10-11-17-8-6-5-7-9-17)27-23(29)20-14-21-19(12-13-30-21)26(20)16(3)25-27/h5-9,12-15,18H,4,10-11H2,1-3H3,(H,24,28) |
| InChIKey | PRGRIIINWRKQGU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |