About 2-ethyl-6,7-dimethoxy-4-(4-pyridin-2-ylpiperazine-1-carbonyl)isoquinolin-1-one
2-ethyl-6,7-dimethoxy-4-(4-pyridin-2-ylpiperazine-1-carbonyl)isoquinolin-1-one (PubChem CID 3241140) has the molecular formula C23H26N4O4
and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-ethyl-6,7-dimethoxy-4-(4-pyridin-2-ylpiperazine-1-carbonyl)isoquinolin-1-one.
Molecular Properties
| Compound Name | 2-ethyl-6,7-dimethoxy-4-(4-pyridin-2-ylpiperazine-1-carbonyl)isoquinolin-1-one |
| PubChem CID | 3241140 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-ethyl-6,7-dimethoxy-4-(4-pyridin-2-ylpiperazine-1-carbonyl)isoquinolin-1-one |
| SMILES | CCn1cc(C(=O)N2CCN(c3ccccn3)CC2)c2cc(OC)c(OC)cc2c1=O |
| InChI | InChI=1S/C23H26N4O4/c1-4-25-15-18(16-13-19(30-2)20(31-3)14-17(16)22(25)28)23(29)27-11-9-26(10-12-27)21-7-5-6-8-24-21/h5-8,13-15H,4,9-12H2,1-3H3 |
| InChIKey | MIOIUMXHXXKJHD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-ethyl-6,7-dimethoxy-4-(4-pyridin-2-ylpiperazine-1-carbonyl)isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-6,7-dimethoxy-4-(4-pyridin-2-ylpiperazine-1-carbonyl)isoquinolin-1-one?
The IUPAC name of 2-ethyl-6,7-dimethoxy-4-(4-pyridin-2-ylpiperazine-1-carbonyl)isoquinolin-1-one (CID 3241140) is 2-ethyl-6,7-dimethoxy-4-(4-pyridin-2-ylpiperazine-1-carbonyl)isoquinolin-1-one.
What is the SMILES notation for 2-ethyl-6,7-dimethoxy-4-(4-pyridin-2-ylpiperazine-1-carbonyl)isoquinolin-1-one?
The canonical SMILES for 2-ethyl-6,7-dimethoxy-4-(4-pyridin-2-ylpiperazine-1-carbonyl)isoquinolin-1-one is CCn1cc(C(=O)N2CCN(c3ccccn3)CC2)c2cc(OC)c(OC)cc2c1=O.
What is the InChIKey of 2-ethyl-6,7-dimethoxy-4-(4-pyridin-2-ylpiperazine-1-carbonyl)isoquinolin-1-one?
The InChIKey is MIOIUMXHXXKJHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N4O4/c1-4-25-15-18(16-13-19(30-2)20(31-3)14-17(16)22(25)28)23(29)27-11-9-26(10-12-27)21-7-5-6-8-24-21/h5-8,13-15H,4,9-12H2,1-3H3.
What are the key properties of 2-ethyl-6,7-dimethoxy-4-(4-pyridin-2-ylpiperazine-1-carbonyl)isoquinolin-1-one?
2-ethyl-6,7-dimethoxy-4-(4-pyridin-2-ylpiperazine-1-carbonyl)isoquinolin-1-one has a molecular weight of 422.49 g/mol, XLogP of 2.40, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-6,7-dimethoxy-4-(4-pyridin-2-ylpiperazine-1-carbonyl)isoquinolin-1-one is sourced from PubChem (CID 3241140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).