About 6-(2,3-dihydroindol-1-yl)-3-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione
6-(2,3-dihydroindol-1-yl)-3-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione (PubChem CID 3241200) has the molecular formula C19H17N3O3
and a molecular weight of 335.36 g/mol. Its IUPAC name is 6-(2,3-dihydroindol-1-yl)-3-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-(2,3-dihydroindol-1-yl)-3-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione |
| PubChem CID | 3241200 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 6-(2,3-dihydroindol-1-yl)-3-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione |
| SMILES | COc1ccc(-n2c(=O)cc(N3CCc4ccccc43)[nH]c2=O)cc1 |
| InChI | InChI=1S/C19H17N3O3/c1-25-15-8-6-14(7-9-15)22-18(23)12-17(20-19(22)24)21-11-10-13-4-2-3-5-16(13)21/h2-9,12H,10-11H2,1H3,(H,20,24) |
| InChIKey | UKZPKPVPRKBBRR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(2,3-dihydroindol-1-yl)-3-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,3-dihydroindol-1-yl)-3-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione?
The IUPAC name of 6-(2,3-dihydroindol-1-yl)-3-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione (CID 3241200) is 6-(2,3-dihydroindol-1-yl)-3-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 6-(2,3-dihydroindol-1-yl)-3-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione?
The canonical SMILES for 6-(2,3-dihydroindol-1-yl)-3-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione is COc1ccc(-n2c(=O)cc(N3CCc4ccccc43)[nH]c2=O)cc1.
What is the InChIKey of 6-(2,3-dihydroindol-1-yl)-3-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione?
The InChIKey is UKZPKPVPRKBBRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O3/c1-25-15-8-6-14(7-9-15)22-18(23)12-17(20-19(22)24)21-11-10-13-4-2-3-5-16(13)21/h2-9,12H,10-11H2,1H3,(H,20,24).
What are the key properties of 6-(2,3-dihydroindol-1-yl)-3-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione?
6-(2,3-dihydroindol-1-yl)-3-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione has a molecular weight of 335.36 g/mol, XLogP of 2.23, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,3-dihydroindol-1-yl)-3-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 3241200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).