C20H22N4O4S — CID 3241269
6-[4-(2,5-dimethylphenyl)piperazin-1-yl]sulfonyl-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 3241269) has the molecular formula C20H22N4O4S and a molecular weight of 414.49 g/mol. Its IUPAC name is 6-[4-(2,5-dimethylphenyl)piperazin-1-yl]sulfonyl-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[4-(2,5-dimethylphenyl)piperazin-1-yl]sulfonyl-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 3241269 |
| Molecular Formula | C20H22N4O4S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 6-[4-(2,5-dimethylphenyl)piperazin-1-yl]sulfonyl-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | Cc1ccc(C)c(N2CCN(S(=O)(=O)c3ccc4[nH]c(=O)c(=O)[nH]c4c3)CC2)c1 |
| InChI | InChI=1S/C20H22N4O4S/c1-13-3-4-14(2)18(11-13)23-7-9-24(10-8-23)29(27,28)15-5-6-16-17(12-15)22-20(26)19(25)21-16/h3-6,11-12H,7-10H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | MNNLNVIIHYYJSB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|