About ethyl 4-[[2-(3-ethylanilino)-3,4-dioxocyclobuten-1-yl]amino]piperidine-1-carboxylate
ethyl 4-[[2-(3-ethylanilino)-3,4-dioxocyclobuten-1-yl]amino]piperidine-1-carboxylate (PubChem CID 3241279) has the molecular formula C20H25N3O4
and a molecular weight of 371.44 g/mol. Its IUPAC name is ethyl 4-[[2-(3-ethylanilino)-3,4-dioxocyclobuten-1-yl]amino]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[[2-(3-ethylanilino)-3,4-dioxocyclobuten-1-yl]amino]piperidine-1-carboxylate |
| PubChem CID | 3241279 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | ethyl 4-[[2-(3-ethylanilino)-3,4-dioxocyclobuten-1-yl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2c(Nc3cccc(CC)c3)c(=O)c2=O)CC1 |
| InChI | InChI=1S/C20H25N3O4/c1-3-13-6-5-7-15(12-13)22-17-16(18(24)19(17)25)21-14-8-10-23(11-9-14)20(26)27-4-2/h5-7,12,14,21-22H,3-4,8-11H2,1-2H3 |
| InChIKey | GCSSZOOHFWEMGE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[[2-(3-ethylanilino)-3,4-dioxocyclobuten-1-yl]amino]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[[2-(3-ethylanilino)-3,4-dioxocyclobuten-1-yl]amino]piperidine-1-carboxylate?
The IUPAC name of ethyl 4-[[2-(3-ethylanilino)-3,4-dioxocyclobuten-1-yl]amino]piperidine-1-carboxylate (CID 3241279) is ethyl 4-[[2-(3-ethylanilino)-3,4-dioxocyclobuten-1-yl]amino]piperidine-1-carboxylate.
What is the SMILES notation for ethyl 4-[[2-(3-ethylanilino)-3,4-dioxocyclobuten-1-yl]amino]piperidine-1-carboxylate?
The canonical SMILES for ethyl 4-[[2-(3-ethylanilino)-3,4-dioxocyclobuten-1-yl]amino]piperidine-1-carboxylate is CCOC(=O)N1CCC(Nc2c(Nc3cccc(CC)c3)c(=O)c2=O)CC1.
What is the InChIKey of ethyl 4-[[2-(3-ethylanilino)-3,4-dioxocyclobuten-1-yl]amino]piperidine-1-carboxylate?
The InChIKey is GCSSZOOHFWEMGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N3O4/c1-3-13-6-5-7-15(12-13)22-17-16(18(24)19(17)25)21-14-8-10-23(11-9-14)20(26)27-4-2/h5-7,12,14,21-22H,3-4,8-11H2,1-2H3.
What are the key properties of ethyl 4-[[2-(3-ethylanilino)-3,4-dioxocyclobuten-1-yl]amino]piperidine-1-carboxylate?
ethyl 4-[[2-(3-ethylanilino)-3,4-dioxocyclobuten-1-yl]amino]piperidine-1-carboxylate has a molecular weight of 371.44 g/mol, XLogP of 2.62, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[[2-(3-ethylanilino)-3,4-dioxocyclobuten-1-yl]amino]piperidine-1-carboxylate is sourced from PubChem (CID 3241279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).