C21H18N4O4 — CID 3241368
methyl 7-(4-benzoyloxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 3241368) has the molecular formula C21H18N4O4 and a molecular weight of 390.40 g/mol. Its IUPAC name is methyl 7-(4-benzoyloxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | methyl 7-(4-benzoyloxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 3241368 |
| Molecular Formula | C21H18N4O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | methyl 7-(4-benzoyloxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | COC(=O)C1=C(C)Nc2ncnn2C1c1ccc(OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H18N4O4/c1-13-17(20(27)28-2)18(25-21(24-13)22-12-23-25)14-8-10-16(11-9-14)29-19(26)15-6-4-3-5-7-15/h3-12,18H,1-2H3,(H,22,23,24) |
| InChIKey | MRUKKQUCKOREOL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|