About 6-(1,3-benzodioxol-5-ylmethylamino)-3-(4-chlorophenyl)-1H-pyrimidine-2,4-dione
6-(1,3-benzodioxol-5-ylmethylamino)-3-(4-chlorophenyl)-1H-pyrimidine-2,4-dione (PubChem CID 3241391) has the molecular formula C18H14ClN3O4
and a molecular weight of 371.78 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-ylmethylamino)-3-(4-chlorophenyl)-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-(1,3-benzodioxol-5-ylmethylamino)-3-(4-chlorophenyl)-1H-pyrimidine-2,4-dione |
| PubChem CID | 3241391 |
| Molecular Formula | C18H14ClN3O4 |
| Molecular Weight | 371.78 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 6-(1,3-benzodioxol-5-ylmethylamino)-3-(4-chlorophenyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc(NCc2ccc3c(c2)OCO3)[nH]c(=O)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14ClN3O4/c19-12-2-4-13(5-3-12)22-17(23)8-16(21-18(22)24)20-9-11-1-6-14-15(7-11)26-10-25-14/h1-8,20H,9-10H2,(H,21,24) |
| InChIKey | UZZYYMHKNLWPCV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.78 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(1,3-benzodioxol-5-ylmethylamino)-3-(4-chlorophenyl)-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,3-benzodioxol-5-ylmethylamino)-3-(4-chlorophenyl)-1H-pyrimidine-2,4-dione?
The IUPAC name of 6-(1,3-benzodioxol-5-ylmethylamino)-3-(4-chlorophenyl)-1H-pyrimidine-2,4-dione (CID 3241391) is 6-(1,3-benzodioxol-5-ylmethylamino)-3-(4-chlorophenyl)-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 6-(1,3-benzodioxol-5-ylmethylamino)-3-(4-chlorophenyl)-1H-pyrimidine-2,4-dione?
The canonical SMILES for 6-(1,3-benzodioxol-5-ylmethylamino)-3-(4-chlorophenyl)-1H-pyrimidine-2,4-dione is O=c1cc(NCc2ccc3c(c2)OCO3)[nH]c(=O)n1-c1ccc(Cl)cc1.
What is the InChIKey of 6-(1,3-benzodioxol-5-ylmethylamino)-3-(4-chlorophenyl)-1H-pyrimidine-2,4-dione?
The InChIKey is UZZYYMHKNLWPCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14ClN3O4/c19-12-2-4-13(5-3-12)22-17(23)8-16(21-18(22)24)20-9-11-1-6-14-15(7-11)26-10-25-14/h1-8,20H,9-10H2,(H,21,24).
What are the key properties of 6-(1,3-benzodioxol-5-ylmethylamino)-3-(4-chlorophenyl)-1H-pyrimidine-2,4-dione?
6-(1,3-benzodioxol-5-ylmethylamino)-3-(4-chlorophenyl)-1H-pyrimidine-2,4-dione has a molecular weight of 371.78 g/mol, XLogP of 2.52, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,3-benzodioxol-5-ylmethylamino)-3-(4-chlorophenyl)-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 3241391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).