C13H17N3O5S2 — CID 3241534
3,5-dimethyl-N-[2-(4-sulfamoylphenyl)ethyl]-1,2-oxazole-4-sulfonamide (PubChem CID 3241534) has the molecular formula C13H17N3O5S2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 3,5-dimethyl-N-[2-(4-sulfamoylphenyl)ethyl]-1,2-oxazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-N-[2-(4-sulfamoylphenyl)ethyl]-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 3241534 |
| Molecular Formula | C13H17N3O5S2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 3,5-dimethyl-N-[2-(4-sulfamoylphenyl)ethyl]-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C13H17N3O5S2/c1-9-13(10(2)21-16-9)23(19,20)15-8-7-11-3-5-12(6-4-11)22(14,17)18/h3-6,15H,7-8H2,1-2H3,(H2,14,17,18) |
| InChIKey | DJEAOOCVJXJGRE-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 132.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |