About 2-methyl-N-(2-oxo-1,3-benzoxathiol-5-yl)-N-thiophen-2-ylsulfonylpropanamide
2-methyl-N-(2-oxo-1,3-benzoxathiol-5-yl)-N-thiophen-2-ylsulfonylpropanamide (PubChem CID 3241610) has the molecular formula C15H13NO5S3
and a molecular weight of 383.47 g/mol. Its IUPAC name is 2-methyl-N-(2-oxo-1,3-benzoxathiol-5-yl)-N-thiophen-2-ylsulfonylpropanamide.
Molecular Properties
| Compound Name | 2-methyl-N-(2-oxo-1,3-benzoxathiol-5-yl)-N-thiophen-2-ylsulfonylpropanamide |
| PubChem CID | 3241610 |
| Molecular Formula | C15H13NO5S3 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | 2-methyl-N-(2-oxo-1,3-benzoxathiol-5-yl)-N-thiophen-2-ylsulfonylpropanamide |
| SMILES | CC(C)C(=O)N(c1ccc2oc(=O)sc2c1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C15H13NO5S3/c1-9(2)14(17)16(24(19,20)13-4-3-7-22-13)10-5-6-11-12(8-10)23-15(18)21-11/h3-9H,1-2H3 |
| InChIKey | XZAOEHJVQVQUDF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-(2-oxo-1,3-benzoxathiol-5-yl)-N-thiophen-2-ylsulfonylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(2-oxo-1,3-benzoxathiol-5-yl)-N-thiophen-2-ylsulfonylpropanamide?
The IUPAC name of 2-methyl-N-(2-oxo-1,3-benzoxathiol-5-yl)-N-thiophen-2-ylsulfonylpropanamide (CID 3241610) is 2-methyl-N-(2-oxo-1,3-benzoxathiol-5-yl)-N-thiophen-2-ylsulfonylpropanamide.
What is the SMILES notation for 2-methyl-N-(2-oxo-1,3-benzoxathiol-5-yl)-N-thiophen-2-ylsulfonylpropanamide?
The canonical SMILES for 2-methyl-N-(2-oxo-1,3-benzoxathiol-5-yl)-N-thiophen-2-ylsulfonylpropanamide is CC(C)C(=O)N(c1ccc2oc(=O)sc2c1)S(=O)(=O)c1cccs1.
What is the InChIKey of 2-methyl-N-(2-oxo-1,3-benzoxathiol-5-yl)-N-thiophen-2-ylsulfonylpropanamide?
The InChIKey is XZAOEHJVQVQUDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO5S3/c1-9(2)14(17)16(24(19,20)13-4-3-7-22-13)10-5-6-11-12(8-10)23-15(18)21-11/h3-9H,1-2H3.
What are the key properties of 2-methyl-N-(2-oxo-1,3-benzoxathiol-5-yl)-N-thiophen-2-ylsulfonylpropanamide?
2-methyl-N-(2-oxo-1,3-benzoxathiol-5-yl)-N-thiophen-2-ylsulfonylpropanamide has a molecular weight of 383.47 g/mol, XLogP of 3.29, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(2-oxo-1,3-benzoxathiol-5-yl)-N-thiophen-2-ylsulfonylpropanamide is sourced from PubChem (CID 3241610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).