C24H28N4O5 — CID 3241697
N-[2-(3,4-diethoxyphenyl)ethyl]-2-(12-methyl-9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)propanamide (PubChem CID 3241697) has the molecular formula C24H28N4O5 and a molecular weight of 452.51 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-2-(12-methyl-9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)propanamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-(12-methyl-9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)propanamide |
|---|---|
| PubChem CID | 3241697 |
| Molecular Formula | C24H28N4O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-(12-methyl-9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)propanamide |
| SMILES | CCOc1ccc(CCNC(=O)C(C)n2nc(C)n3c(cc4occc43)c2=O)cc1OCC |
| InChI | InChI=1S/C24H28N4O5/c1-5-31-20-8-7-17(13-22(20)32-6-2)9-11-25-23(29)15(3)28-24(30)19-14-21-18(10-12-33-21)27(19)16(4)26-28/h7-8,10,12-15H,5-6,9,11H2,1-4H3,(H,25,29) |
| InChIKey | QMVPPTLKACBKMK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |