About 3-benzyl-6-pentyl-1,3-diazinane-2,4-dione
3-benzyl-6-pentyl-1,3-diazinane-2,4-dione (PubChem CID 3241737) has the molecular formula C16H22N2O2
and a molecular weight of 274.36 g/mol. Its IUPAC name is 3-benzyl-6-pentyl-1,3-diazinane-2,4-dione.
Molecular Properties
| Compound Name | 3-benzyl-6-pentyl-1,3-diazinane-2,4-dione |
| PubChem CID | 3241737 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 3-benzyl-6-pentyl-1,3-diazinane-2,4-dione |
| SMILES | CCCCCC1CC(=O)N(Cc2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C16H22N2O2/c1-2-3-5-10-14-11-15(19)18(16(20)17-14)12-13-8-6-4-7-9-13/h4,6-9,14H,2-3,5,10-12H2,1H3,(H,17,20) |
| InChIKey | CPUABHPHABOANU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-6-pentyl-1,3-diazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-6-pentyl-1,3-diazinane-2,4-dione?
The IUPAC name of 3-benzyl-6-pentyl-1,3-diazinane-2,4-dione (CID 3241737) is 3-benzyl-6-pentyl-1,3-diazinane-2,4-dione.
What is the SMILES notation for 3-benzyl-6-pentyl-1,3-diazinane-2,4-dione?
The canonical SMILES for 3-benzyl-6-pentyl-1,3-diazinane-2,4-dione is CCCCCC1CC(=O)N(Cc2ccccc2)C(=O)N1.
What is the InChIKey of 3-benzyl-6-pentyl-1,3-diazinane-2,4-dione?
The InChIKey is CPUABHPHABOANU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O2/c1-2-3-5-10-14-11-15(19)18(16(20)17-14)12-13-8-6-4-7-9-13/h4,6-9,14H,2-3,5,10-12H2,1H3,(H,17,20).
What are the key properties of 3-benzyl-6-pentyl-1,3-diazinane-2,4-dione?
3-benzyl-6-pentyl-1,3-diazinane-2,4-dione has a molecular weight of 274.36 g/mol, XLogP of 3.08, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-6-pentyl-1,3-diazinane-2,4-dione is sourced from PubChem (CID 3241737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).