About N-[4-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methylsulfamoyl]phenyl]acetamide
N-[4-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methylsulfamoyl]phenyl]acetamide (PubChem CID 3241778) has the molecular formula C17H16N4O3S2
and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[4-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methylsulfamoyl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methylsulfamoyl]phenyl]acetamide |
| PubChem CID | 3241778 |
| Molecular Formula | C17H16N4O3S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | N-[4-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methylsulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCc2csc(-c3cccnc3)n2)cc1 |
| InChI | InChI=1S/C17H16N4O3S2/c1-12(22)20-14-4-6-16(7-5-14)26(23,24)19-10-15-11-25-17(21-15)13-3-2-8-18-9-13/h2-9,11,19H,10H2,1H3,(H,20,22) |
| InChIKey | NOHIGAPIAVRHRP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methylsulfamoyl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methylsulfamoyl]phenyl]acetamide?
The IUPAC name of N-[4-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methylsulfamoyl]phenyl]acetamide (CID 3241778) is N-[4-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methylsulfamoyl]phenyl]acetamide.
What is the SMILES notation for N-[4-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methylsulfamoyl]phenyl]acetamide?
The canonical SMILES for N-[4-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methylsulfamoyl]phenyl]acetamide is CC(=O)Nc1ccc(S(=O)(=O)NCc2csc(-c3cccnc3)n2)cc1.
What is the InChIKey of N-[4-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methylsulfamoyl]phenyl]acetamide?
The InChIKey is NOHIGAPIAVRHRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O3S2/c1-12(22)20-14-4-6-16(7-5-14)26(23,24)19-10-15-11-25-17(21-15)13-3-2-8-18-9-13/h2-9,11,19H,10H2,1H3,(H,20,22).
What are the key properties of N-[4-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methylsulfamoyl]phenyl]acetamide?
N-[4-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methylsulfamoyl]phenyl]acetamide has a molecular weight of 388.47 g/mol, XLogP of 2.64, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methylsulfamoyl]phenyl]acetamide is sourced from PubChem (CID 3241778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).