About 1-(4-chlorophenyl)-N,N-bis(2-methoxyethyl)pyrazolo[5,4-d]pyrimidin-4-amine
1-(4-chlorophenyl)-N,N-bis(2-methoxyethyl)pyrazolo[5,4-d]pyrimidin-4-amine (PubChem CID 3241906) has the molecular formula C17H20ClN5O2
and a molecular weight of 361.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N,N-bis(2-methoxyethyl)pyrazolo[5,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-N,N-bis(2-methoxyethyl)pyrazolo[5,4-d]pyrimidin-4-amine |
| PubChem CID | 3241906 |
| Molecular Formula | C17H20ClN5O2 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 1-(4-chlorophenyl)-N,N-bis(2-methoxyethyl)pyrazolo[5,4-d]pyrimidin-4-amine |
| SMILES | COCCN(CCOC)c1ncnc2c1cnn2-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H20ClN5O2/c1-24-9-7-22(8-10-25-2)16-15-11-21-23(17(15)20-12-19-16)14-5-3-13(18)4-6-14/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | WEIOKHLIOSZENK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-(4-chlorophenyl)-N,N-bis(2-methoxyethyl)pyrazolo[5,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-N,N-bis(2-methoxyethyl)pyrazolo[5,4-d]pyrimidin-4-amine?
The IUPAC name of 1-(4-chlorophenyl)-N,N-bis(2-methoxyethyl)pyrazolo[5,4-d]pyrimidin-4-amine (CID 3241906) is 1-(4-chlorophenyl)-N,N-bis(2-methoxyethyl)pyrazolo[5,4-d]pyrimidin-4-amine.
What is the SMILES notation for 1-(4-chlorophenyl)-N,N-bis(2-methoxyethyl)pyrazolo[5,4-d]pyrimidin-4-amine?
The canonical SMILES for 1-(4-chlorophenyl)-N,N-bis(2-methoxyethyl)pyrazolo[5,4-d]pyrimidin-4-amine is COCCN(CCOC)c1ncnc2c1cnn2-c1ccc(Cl)cc1.
What is the InChIKey of 1-(4-chlorophenyl)-N,N-bis(2-methoxyethyl)pyrazolo[5,4-d]pyrimidin-4-amine?
The InChIKey is WEIOKHLIOSZENK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClN5O2/c1-24-9-7-22(8-10-25-2)16-15-11-21-23(17(15)20-12-19-16)14-5-3-13(18)4-6-14/h3-6,11-12H,7-10H2,1-2H3.
What are the key properties of 1-(4-chlorophenyl)-N,N-bis(2-methoxyethyl)pyrazolo[5,4-d]pyrimidin-4-amine?
1-(4-chlorophenyl)-N,N-bis(2-methoxyethyl)pyrazolo[5,4-d]pyrimidin-4-amine has a molecular weight of 361.83 g/mol, XLogP of 2.57, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-N,N-bis(2-methoxyethyl)pyrazolo[5,4-d]pyrimidin-4-amine is sourced from PubChem (CID 3241906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).