C19H20N6O — CID 3241971
13-(furan-2-yl)-4,6-dimethyl-11-piperidin-1-yl-3,7,8,10,12-pentazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene (PubChem CID 3241971) has the molecular formula C19H20N6O and a molecular weight of 348.41 g/mol. Its IUPAC name is 13-(furan-2-yl)-4,6-dimethyl-11-piperidin-1-yl-3,7,8,10,12-pentazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene.
| Compound Name | 13-(furan-2-yl)-4,6-dimethyl-11-piperidin-1-yl-3,7,8,10,12-pentazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene |
|---|---|
| PubChem CID | 3241971 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 13-(furan-2-yl)-4,6-dimethyl-11-piperidin-1-yl-3,7,8,10,12-pentazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene |
| SMILES | Cc1cc(C)n2nc3nc(N4CCCCC4)nc(-c4ccco4)c3c2n1 |
| InChI | InChI=1S/C19H20N6O/c1-12-11-13(2)25-18(20-12)15-16(14-7-6-10-26-14)21-19(22-17(15)23-25)24-8-4-3-5-9-24/h6-7,10-11H,3-5,8-9H2,1-2H3 |
| InChIKey | XKUWTASNRXQGAA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 72.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |