About N-(3-chlorophenyl)-5-(2,5-dimethoxyphenyl)-1,2-oxazole-3-carboxamide
N-(3-chlorophenyl)-5-(2,5-dimethoxyphenyl)-1,2-oxazole-3-carboxamide (PubChem CID 3242014) has the molecular formula C18H15ClN2O4
and a molecular weight of 358.78 g/mol. Its IUPAC name is N-(3-chlorophenyl)-5-(2,5-dimethoxyphenyl)-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(3-chlorophenyl)-5-(2,5-dimethoxyphenyl)-1,2-oxazole-3-carboxamide |
| PubChem CID | 3242014 |
| Molecular Formula | C18H15ClN2O4 |
| Molecular Weight | 358.78 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | N-(3-chlorophenyl)-5-(2,5-dimethoxyphenyl)-1,2-oxazole-3-carboxamide |
| SMILES | COc1ccc(OC)c(-c2cc(C(=O)Nc3cccc(Cl)c3)no2)c1 |
| InChI | InChI=1S/C18H15ClN2O4/c1-23-13-6-7-16(24-2)14(9-13)17-10-15(21-25-17)18(22)20-12-5-3-4-11(19)8-12/h3-10H,1-2H3,(H,20,22) |
| InChIKey | XYPFUCMRLGNLML-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.78 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-chlorophenyl)-5-(2,5-dimethoxyphenyl)-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chlorophenyl)-5-(2,5-dimethoxyphenyl)-1,2-oxazole-3-carboxamide?
The IUPAC name of N-(3-chlorophenyl)-5-(2,5-dimethoxyphenyl)-1,2-oxazole-3-carboxamide (CID 3242014) is N-(3-chlorophenyl)-5-(2,5-dimethoxyphenyl)-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-(3-chlorophenyl)-5-(2,5-dimethoxyphenyl)-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-(3-chlorophenyl)-5-(2,5-dimethoxyphenyl)-1,2-oxazole-3-carboxamide is COc1ccc(OC)c(-c2cc(C(=O)Nc3cccc(Cl)c3)no2)c1.
What is the InChIKey of N-(3-chlorophenyl)-5-(2,5-dimethoxyphenyl)-1,2-oxazole-3-carboxamide?
The InChIKey is XYPFUCMRLGNLML-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15ClN2O4/c1-23-13-6-7-16(24-2)14(9-13)17-10-15(21-25-17)18(22)20-12-5-3-4-11(19)8-12/h3-10H,1-2H3,(H,20,22).
What are the key properties of N-(3-chlorophenyl)-5-(2,5-dimethoxyphenyl)-1,2-oxazole-3-carboxamide?
N-(3-chlorophenyl)-5-(2,5-dimethoxyphenyl)-1,2-oxazole-3-carboxamide has a molecular weight of 358.78 g/mol, XLogP of 4.26, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chlorophenyl)-5-(2,5-dimethoxyphenyl)-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 3242014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).