C19H16O6 — CID 3242032
dimethyl spiro[1,3-dioxolane-2,9'-fluorene]-4,5-dicarboxylate (PubChem CID 3242032) has the molecular formula C19H16O6 and a molecular weight of 340.33 g/mol. Its IUPAC name is dimethyl spiro[1,3-dioxolane-2,9'-fluorene]-4,5-dicarboxylate.
| Compound Name | dimethyl spiro[1,3-dioxolane-2,9'-fluorene]-4,5-dicarboxylate |
|---|---|
| PubChem CID | 3242032 |
| Molecular Formula | C19H16O6 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | dimethyl spiro[1,3-dioxolane-2,9'-fluorene]-4,5-dicarboxylate |
| SMILES | COC(=O)C1OC2(OC1C(=O)OC)c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C19H16O6/c1-22-17(20)15-16(18(21)23-2)25-19(24-15)13-9-5-3-7-11(13)12-8-4-6-10-14(12)19/h3-10,15-16H,1-2H3 |
| InChIKey | ZMWYEJCWZYKYJY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |