C21H23N3O5 — CID 3242130
N-(2,5-diethoxyphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)butanamide (PubChem CID 3242130) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is N-(2,5-diethoxyphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)butanamide.
| Compound Name | N-(2,5-diethoxyphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)butanamide |
|---|---|
| PubChem CID | 3242130 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-(2,5-diethoxyphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)butanamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)CCCN2C(=O)c3cccnc3C2=O)c1 |
| InChI | InChI=1S/C21H23N3O5/c1-3-28-14-9-10-17(29-4-2)16(13-14)23-18(25)8-6-12-24-20(26)15-7-5-11-22-19(15)21(24)27/h5,7,9-11,13H,3-4,6,8,12H2,1-2H3,(H,23,25) |
| InChIKey | SKNGPECBRQYJOJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|