C24H28N2O8 — CID 3242154
2-[2-[2-(2,2-dimethylpropanoyloxy)ethyl]-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 3242154) has the molecular formula C24H28N2O8 and a molecular weight of 472.49 g/mol. Its IUPAC name is 2-[2-[2-(2,2-dimethylpropanoyloxy)ethyl]-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[2-[2-(2,2-dimethylpropanoyloxy)ethyl]-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 3242154 |
| Molecular Formula | C24H28N2O8 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 2-[2-[2-(2,2-dimethylpropanoyloxy)ethyl]-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCCn1c(=O)c2cc3c(=O)n(CCOC(=O)C(C)(C)C)c(=O)c3cc2c1=O |
| InChI | InChI=1S/C24H28N2O8/c1-23(2,3)21(31)33-9-7-25-17(27)13-11-15-16(12-14(13)18(25)28)20(30)26(19(15)29)8-10-34-22(32)24(4,5)6/h11-12H,7-10H2,1-6H3 |
| InChIKey | FFVNMUMIHFMYNW-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 130.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |