C14H15NO4S2 — CID 3242326
N-(3-methoxyphenyl)-3-thiophen-2-ylsulfonylpropanamide (PubChem CID 3242326) has the molecular formula C14H15NO4S2 and a molecular weight of 325.41 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-3-thiophen-2-ylsulfonylpropanamide.
| Compound Name | N-(3-methoxyphenyl)-3-thiophen-2-ylsulfonylpropanamide |
|---|---|
| PubChem CID | 3242326 |
| Molecular Formula | C14H15NO4S2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | N-(3-methoxyphenyl)-3-thiophen-2-ylsulfonylpropanamide |
| SMILES | COc1cccc(NC(=O)CCS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C14H15NO4S2/c1-19-12-5-2-4-11(10-12)15-13(16)7-9-21(17,18)14-6-3-8-20-14/h2-6,8,10H,7,9H2,1H3,(H,15,16) |
| InChIKey | OACALINOSGXHPE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |