About ethyl 1-methyl-4-oxopiperidine-3-carboxylate;hydron;chloride
ethyl 1-methyl-4-oxopiperidine-3-carboxylate;hydron;chloride (PubChem CID 3242377) has the molecular formula C9H16ClNO3
and a molecular weight of 221.68 g/mol. Its IUPAC name is ethyl 1-methyl-4-oxopiperidine-3-carboxylate;hydron;chloride.
Molecular Properties
| Compound Name | ethyl 1-methyl-4-oxopiperidine-3-carboxylate;hydron;chloride |
| PubChem CID | 3242377 |
| Molecular Formula | C9H16ClNO3 |
| Molecular Weight | 221.68 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | ethyl 1-methyl-4-oxopiperidine-3-carboxylate;hydron;chloride |
| SMILES | CCOC(=O)C1CN(C)CCC1=O.[Cl-].[H+] |
| InChI | InChI=1S/C9H15NO3.ClH/c1-3-13-9(12)7-6-10(2)5-4-8(7)11;/h7H,3-6H2,1-2H3;1H |
| InChIKey | FOFWPLJYPWOBJX-UHFFFAOYSA-N |
| XLogP | -2.81 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.68 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-methyl-4-oxopiperidine-3-carboxylate;hydron;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-methyl-4-oxopiperidine-3-carboxylate;hydron;chloride?
The IUPAC name of ethyl 1-methyl-4-oxopiperidine-3-carboxylate;hydron;chloride (CID 3242377) is ethyl 1-methyl-4-oxopiperidine-3-carboxylate;hydron;chloride.
What is the SMILES notation for ethyl 1-methyl-4-oxopiperidine-3-carboxylate;hydron;chloride?
The canonical SMILES for ethyl 1-methyl-4-oxopiperidine-3-carboxylate;hydron;chloride is CCOC(=O)C1CN(C)CCC1=O.[Cl-].[H+].
What is the InChIKey of ethyl 1-methyl-4-oxopiperidine-3-carboxylate;hydron;chloride?
The InChIKey is FOFWPLJYPWOBJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3.ClH/c1-3-13-9(12)7-6-10(2)5-4-8(7)11;/h7H,3-6H2,1-2H3;1H.
What are the key properties of ethyl 1-methyl-4-oxopiperidine-3-carboxylate;hydron;chloride?
ethyl 1-methyl-4-oxopiperidine-3-carboxylate;hydron;chloride has a molecular weight of 221.68 g/mol, XLogP of -2.81, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-methyl-4-oxopiperidine-3-carboxylate;hydron;chloride is sourced from PubChem (CID 3242377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).