C21H18N4O4S — CID 3242435
2-[[2-(1H-imidazol-5-ylsulfonyl)-3,4-dihydro-1H-isoquinolin-1-yl]methyl]isoindole-1,3-dione (PubChem CID 3242435) has the molecular formula C21H18N4O4S and a molecular weight of 422.47 g/mol. Its IUPAC name is 2-[[2-(1H-imidazol-5-ylsulfonyl)-3,4-dihydro-1H-isoquinolin-1-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[2-(1H-imidazol-5-ylsulfonyl)-3,4-dihydro-1H-isoquinolin-1-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 3242435 |
| Molecular Formula | C21H18N4O4S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 2-[[2-(1H-imidazol-5-ylsulfonyl)-3,4-dihydro-1H-isoquinolin-1-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC1c2ccccc2CCN1S(=O)(=O)c1cnc[nH]1 |
| InChI | InChI=1S/C21H18N4O4S/c26-20-16-7-3-4-8-17(16)21(27)24(20)12-18-15-6-2-1-5-14(15)9-10-25(18)30(28,29)19-11-22-13-23-19/h1-8,11,13,18H,9-10,12H2,(H,22,23) |
| InChIKey | ASNLWMSJHYKSIL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|